C20H38O2Si — CID 101266056
trimethyl-[2-[[(2R,4S)-2-[(E)-non-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane (PubChem CID 101266056) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is trimethyl-[2-[[(2R,4S)-2-[(E)-non-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane.
| Compound Name | trimethyl-[2-[[(2R,4S)-2-[(E)-non-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 101266056 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | trimethyl-[2-[[(2R,4S)-2-[(E)-non-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane |
| SMILES | C=C(C[C@H]1CCO[C@@H](/C=C/CCCCCCC)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-6-7-8-9-10-11-12-13-20-21-15-14-19(22-20)16-18(2)17-23(3,4)5/h12-13,19-20H,2,6-11,14-17H2,1,3-5H3/b13-12+/t19-,20-/m1/s1 |
| InChIKey | QMJFAUKRZAIHHW-OKLSWEBGSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|