C18H32N4 — CID 101267158
1-N,4-N-dipropyl-3,6-bis(propylimino)cyclohexa-1,4-diene-1,4-diamine (PubChem CID 101267158) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-N,4-N-dipropyl-3,6-bis(propylimino)cyclohexa-1,4-diene-1,4-diamine.
| Compound Name | 1-N,4-N-dipropyl-3,6-bis(propylimino)cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 101267158 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1-N,4-N-dipropyl-3,6-bis(propylimino)cyclohexa-1,4-diene-1,4-diamine |
| SMILES | CCC/N=C1\C=C(NCCC)/C(=N/CCC)C=C1NCCC |
| InChI | InChI=1S/C18H32N4/c1-5-9-19-15-13-17(21-11-7-3)18(22-12-8-4)14-16(15)20-10-6-2/h13-14,19,22H,5-12H2,1-4H3/b20-16+,21-17+ |
| InChIKey | JVCHOFPISROCGB-NWILIBCHSA-N |
| XLogP | 3.47 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|