C26H49ClN4 — CID 139119792
[2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium chloride (PubChem CID 139119792) has the molecular formula C26H49ClN4 and a molecular weight of 453.16 g/mol. Its IUPAC name is [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium chloride.
| Compound Name | [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium chloride |
|---|---|
| PubChem CID | 139119792 |
| Molecular Formula | C26H49ClN4 |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium chloride |
| SMILES | CC(C)(C)C/N=C1\C=C(NCC(C)(C)C)/C(=[NH+]/CC(C)(C)C)C=C1NCC(C)(C)C.[Cl-] |
| InChI | InChI=1S/C26H48N4.ClH/c1-23(2,3)15-27-19-13-21(29-17-25(7,8)9)22(30-18-26(10,11)12)14-20(19)28-16-24(4,5)6;/h13-14,27,30H,15-18H2,1-12H3;1H/b28-20+,29-21+; |
| InChIKey | LJXONQLURNSXRM-SUEDXHKUSA-N |
| XLogP | 1.10 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|