C26H49N4+ — CID 5243379
[2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium (PubChem CID 5243379) has the molecular formula C26H49N4+ and a molecular weight of 417.71 g/mol. Its IUPAC name is [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium.
| Compound Name | [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium |
|---|---|
| PubChem CID | 5243379 |
| Molecular Formula | C26H49N4+ |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.40 |
| IUPAC Name | [2,5-bis(2,2-dimethylpropylamino)-4-(2,2-dimethylpropylimino)cyclohexa-2,5-dien-1-ylidene]-(2,2-dimethylpropyl)azanium |
| SMILES | CC(C)(C)C/N=C1\C=C(NCC(C)(C)C)/C(=[NH+]/CC(C)(C)C)C=C1NCC(C)(C)C |
| InChI | InChI=1S/C26H48N4/c1-23(2,3)15-27-19-13-21(29-17-25(7,8)9)22(30-18-26(10,11)12)14-20(19)28-16-24(4,5)6/h13-14,27,30H,15-18H2,1-12H3/p+1/b28-20+,29-21+ |
| InChIKey | DZVSYZVPFRVGOO-IABPKXMJSA-O |
| XLogP | 4.09 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|