C26H48N4 — CID 5243380
1-N,4-N-bis(2,2-dimethylpropyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-diene-1,4-diamine (PubChem CID 5243380) has the molecular formula C26H48N4 and a molecular weight of 416.70 g/mol. Its IUPAC name is 1-N,4-N-bis(2,2-dimethylpropyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-diene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(2,2-dimethylpropyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 5243380 |
| Molecular Formula | C26H48N4 |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.39 |
| IUPAC Name | 1-N,4-N-bis(2,2-dimethylpropyl)-3,6-bis(2,2-dimethylpropylimino)cyclohexa-1,4-diene-1,4-diamine |
| SMILES | CC(C)(C)C/N=C1\C=C(NCC(C)(C)C)/C(=N/CC(C)(C)C)C=C1NCC(C)(C)C |
| InChI | InChI=1S/C26H48N4/c1-23(2,3)15-27-19-13-21(29-17-25(7,8)9)22(30-18-26(10,11)12)14-20(19)28-16-24(4,5)6/h13-14,27,30H,15-18H2,1-12H3/b28-20+,29-21+ |
| InChIKey | DZVSYZVPFRVGOO-IABPKXMJSA-N |
| XLogP | 6.01 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|