C24H22O5 — CID 101268085
methyl 15-[(1R,4S,5R)-4-ethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate (PubChem CID 101268085) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 15-[(1R,4S,5R)-4-ethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate.
| Compound Name | methyl 15-[(1R,4S,5R)-4-ethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 101268085 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl 15-[(1R,4S,5R)-4-ethyl-2-oxo-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
| SMILES | CC[C@@H]1OC(=O)[C@]2(C3(C(=O)OC)CC4c5ccccc5C3c3ccccc34)O[C@H]12 |
| InChI | InChI=1S/C24H22O5/c1-3-18-20-24(29-20,22(26)28-18)23(21(25)27-2)12-17-13-8-4-6-10-15(13)19(23)16-11-7-5-9-14(16)17/h4-11,17-20H,3,12H2,1-2H3/t17?,18-,19?,20+,23?,24+/m0/s1 |
| InChIKey | UACCHUOSGHCLLR-VGCWEDFKSA-N |
| XLogP | 3.30 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|