C23H33NO2Si — CID 101268191
[(2S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]aziridin-2-yl]-diphenylmethanol (PubChem CID 101268191) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is [(2S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]aziridin-2-yl]-diphenylmethanol.
| Compound Name | [(2S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]aziridin-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 101268191 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [(2S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]aziridin-2-yl]-diphenylmethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C[C@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO2Si/c1-22(2,3)27(4,5)26-17-16-24-18-21(24)23(25,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,21,25H,16-18H2,1-5H3/t21-,24?/m0/s1 |
| InChIKey | MTIGDSGYMWZERC-XEGCMXMBSA-N |
| XLogP | 4.63 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|