C15H23BrO4Si — CID 101270674
(5S,10S)-9-bromo-10-triethylsilyloxy-1-oxaspiro[4.5]dec-7-ene-2,6-dione (PubChem CID 101270674) has the molecular formula C15H23BrO4Si and a molecular weight of 375.34 g/mol. Its IUPAC name is (5S,10S)-9-bromo-10-triethylsilyloxy-1-oxaspiro[4.5]dec-7-ene-2,6-dione.
| Compound Name | (5S,10S)-9-bromo-10-triethylsilyloxy-1-oxaspiro[4.5]dec-7-ene-2,6-dione |
|---|---|
| PubChem CID | 101270674 |
| Molecular Formula | C15H23BrO4Si |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (5S,10S)-9-bromo-10-triethylsilyloxy-1-oxaspiro[4.5]dec-7-ene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C(Br)C=CC(=O)[C@]12CCC(=O)O2 |
| InChI | InChI=1S/C15H23BrO4Si/c1-4-21(5-2,6-3)20-14-11(16)7-8-12(17)15(14)10-9-13(18)19-15/h7-8,11,14H,4-6,9-10H2,1-3H3/t11?,14-,15-/m1/s1 |
| InChIKey | HWYQMDZYIMUTHI-PJYWTSEFSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|