C19H34O2Si — CID 101270901
tert-butyl-[(1S,2R)-1-(2,5-dihydrofuran-3-yl)-2-ethenylcycloheptyl]oxy-dimethylsilane (PubChem CID 101270901) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-1-(2,5-dihydrofuran-3-yl)-2-ethenylcycloheptyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-1-(2,5-dihydrofuran-3-yl)-2-ethenylcycloheptyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101270901 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl-[(1S,2R)-1-(2,5-dihydrofuran-3-yl)-2-ethenylcycloheptyl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1CCCCC[C@@]1(O[Si](C)(C)C(C)(C)C)C1=CCOC1 |
| InChI | InChI=1S/C19H34O2Si/c1-7-16-11-9-8-10-13-19(16,17-12-14-20-15-17)21-22(5,6)18(2,3)4/h7,12,16H,1,8-11,13-15H2,2-6H3/t16-,19-/m0/s1 |
| InChIKey | ZOEDMZVVUGOQBC-LPHOPBHVSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|