C24H37NO3SSi — CID 101270903
tert-butyl-[(1S,2R)-2-ethenyl-1-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopentyl]oxy-dimethylsilane (PubChem CID 101270903) has the molecular formula C24H37NO3SSi and a molecular weight of 447.72 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-ethenyl-1-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-2-ethenyl-1-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101270903 |
| Molecular Formula | C24H37NO3SSi |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-ethenyl-1-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopentyl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1CCC[C@@]1(O[Si](C)(C)C(C)(C)C)C1=CCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H37NO3SSi/c1-8-20-10-9-16-24(20,28-30(6,7)23(3,4)5)21-15-17-25(18-21)29(26,27)22-13-11-19(2)12-14-22/h8,11-15,20H,1,9-10,16-18H2,2-7H3/t20-,24-/m0/s1 |
| InChIKey | NLGWGNVYRIZBFZ-RDPSFJRHSA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|