C17H25NO2SSi — CID 101388735
trimethyl-[(1S,2S)-2-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopropyl]silane (PubChem CID 101388735) has the molecular formula C17H25NO2SSi and a molecular weight of 335.55 g/mol. Its IUPAC name is trimethyl-[(1S,2S)-2-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopropyl]silane.
| Compound Name | trimethyl-[(1S,2S)-2-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopropyl]silane |
|---|---|
| PubChem CID | 101388735 |
| Molecular Formula | C17H25NO2SSi |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | trimethyl-[(1S,2S)-2-[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]cyclopropyl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C([C@@H]3C[C@@H]3[Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C17H25NO2SSi/c1-13-5-7-15(8-6-13)21(19,20)18-10-9-14(12-18)16-11-17(16)22(2,3)4/h5-9,16-17H,10-12H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | IOLZNOHSDKYLFC-IRXDYDNUSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|