C24H27NO5S2 — CID 139187981
3-[(3R,5R)-4-methylidene-5-(4-methylphenyl)sulfonyloxan-3-yl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 139187981) has the molecular formula C24H27NO5S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 3-[(3R,5R)-4-methylidene-5-(4-methylphenyl)sulfonyloxan-3-yl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 3-[(3R,5R)-4-methylidene-5-(4-methylphenyl)sulfonyloxan-3-yl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 139187981 |
| Molecular Formula | C24H27NO5S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-[(3R,5R)-4-methylidene-5-(4-methylphenyl)sulfonyloxan-3-yl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | C=C1[C@@H](C2=CCN(S(=O)(=O)c3ccc(C)cc3)C2)COC[C@@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO5S2/c1-17-4-8-21(9-5-17)31(26,27)24-16-30-15-23(19(24)3)20-12-13-25(14-20)32(28,29)22-10-6-18(2)7-11-22/h4-12,23-24H,3,13-16H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | DGFBTDFBIXJTFC-ZEQRLZLVSA-N |
| XLogP | 3.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|