C15H22Br2O — CID 101272807
4-[(1S,3S,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-1-methylcyclopent-2-en-1-ol (PubChem CID 101272807) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is 4-[(1S,3S,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-1-methylcyclopent-2-en-1-ol.
| Compound Name | 4-[(1S,3S,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-1-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 101272807 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 4-[(1S,3S,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-1-methylcyclopent-2-en-1-ol |
| SMILES | C=C1[C@@H](Br)C[C@H](Br)C(C)(C)[C@@H]1C1C=CC(C)(O)C1 |
| InChI | InChI=1S/C15H22Br2O/c1-9-11(16)7-12(17)14(2,3)13(9)10-5-6-15(4,18)8-10/h5-6,10-13,18H,1,7-8H2,2-4H3/t10?,11-,12-,13-,15?/m0/s1 |
| InChIKey | DDQMZNUBSGGNSY-XWRJPITESA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|