C23H32NO4+ — CID 101272941
[5-tert-butyl-2-[(4-methoxycarbonylphenyl)methoxy]phenyl]methyl-(3-hydroxypropyl)azanium (PubChem CID 101272941) has the molecular formula C23H32NO4+ and a molecular weight of 386.51 g/mol. Its IUPAC name is [5-tert-butyl-2-[(4-methoxycarbonylphenyl)methoxy]phenyl]methyl-(3-hydroxypropyl)azanium.
| Compound Name | [5-tert-butyl-2-[(4-methoxycarbonylphenyl)methoxy]phenyl]methyl-(3-hydroxypropyl)azanium |
|---|---|
| PubChem CID | 101272941 |
| Molecular Formula | C23H32NO4+ |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [5-tert-butyl-2-[(4-methoxycarbonylphenyl)methoxy]phenyl]methyl-(3-hydroxypropyl)azanium |
| SMILES | COC(=O)c1ccc(COc2ccc(C(C)(C)C)cc2C[NH2+]CCCO)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-23(2,3)20-10-11-21(19(14-20)15-24-12-5-13-25)28-16-17-6-8-18(9-7-17)22(26)27-4/h6-11,14,24-25H,5,12-13,15-16H2,1-4H3/p+1 |
| InChIKey | UGLGEXWMGBKFJD-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|