About (E)-1-aminonon-6-en-2-ol
(E)-1-aminonon-6-en-2-ol (PubChem CID 101275258) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (E)-1-aminonon-6-en-2-ol.
Molecular Properties
| Compound Name | (E)-1-aminonon-6-en-2-ol |
| PubChem CID | 101275258 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (E)-1-aminonon-6-en-2-ol |
| SMILES | CC/C=C/CCCC(O)CN |
| InChI | InChI=1S/C9H19NO/c1-2-3-4-5-6-7-9(11)8-10/h3-4,9,11H,2,5-8,10H2,1H3/b4-3+ |
| InChIKey | KLHGUPYACZNWIU-ONEGZZNKSA-N |
| XLogP | 1.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-aminonon-6-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-aminonon-6-en-2-ol?
The IUPAC name of (E)-1-aminonon-6-en-2-ol (CID 101275258) is (E)-1-aminonon-6-en-2-ol.
What is the SMILES notation for (E)-1-aminonon-6-en-2-ol?
The canonical SMILES for (E)-1-aminonon-6-en-2-ol is CC/C=C/CCCC(O)CN.
What is the InChIKey of (E)-1-aminonon-6-en-2-ol?
The InChIKey is KLHGUPYACZNWIU-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H19NO/c1-2-3-4-5-6-7-9(11)8-10/h3-4,9,11H,2,5-8,10H2,1H3/b4-3+.
What are the key properties of (E)-1-aminonon-6-en-2-ol?
(E)-1-aminonon-6-en-2-ol has a molecular weight of 157.26 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-aminonon-6-en-2-ol is sourced from PubChem (CID 101275258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).