C16H32NO3+ — CID 101276687
carboxymethyl-[(E)-2-hydroxyoct-4-enyl]-dipropylazanium (PubChem CID 101276687) has the molecular formula C16H32NO3+ and a molecular weight of 286.44 g/mol. Its IUPAC name is carboxymethyl-[(E)-2-hydroxyoct-4-enyl]-dipropylazanium.
| Compound Name | carboxymethyl-[(E)-2-hydroxyoct-4-enyl]-dipropylazanium |
|---|---|
| PubChem CID | 101276687 |
| Molecular Formula | C16H32NO3+ |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | carboxymethyl-[(E)-2-hydroxyoct-4-enyl]-dipropylazanium |
| SMILES | CCC/C=C/CC(O)C[N+](CCC)(CCC)CC(=O)O |
| InChI | InChI=1S/C16H31NO3/c1-4-7-8-9-10-15(18)13-17(11-5-2,12-6-3)14-16(19)20/h8-9,15,18H,4-7,10-14H2,1-3H3/p+1/b9-8+ |
| InChIKey | MIOLVVNYJKRLJL-CMDGGOBGSA-O |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|