C21H40N2O5Si — CID 101276852
3-[(1R,2R,3R,5Z)-5-methoxyimino-2-[(3Z)-3-methoxyiminooctyl]-3-trimethylsilyloxycyclopentyl]propanoic acid (PubChem CID 101276852) has the molecular formula C21H40N2O5Si and a molecular weight of 428.65 g/mol. Its IUPAC name is 3-[(1R,2R,3R,5Z)-5-methoxyimino-2-[(3Z)-3-methoxyiminooctyl]-3-trimethylsilyloxycyclopentyl]propanoic acid.
| Compound Name | 3-[(1R,2R,3R,5Z)-5-methoxyimino-2-[(3Z)-3-methoxyiminooctyl]-3-trimethylsilyloxycyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 101276852 |
| Molecular Formula | C21H40N2O5Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 3-[(1R,2R,3R,5Z)-5-methoxyimino-2-[(3Z)-3-methoxyiminooctyl]-3-trimethylsilyloxycyclopentyl]propanoic acid |
| SMILES | CCCCC/C(CC[C@H]1[C@H](O[Si](C)(C)C)C/C(=N/OC)[C@@H]1CCC(=O)O)=N/OC |
| InChI | InChI=1S/C21H40N2O5Si/c1-7-8-9-10-16(22-26-2)11-12-18-17(13-14-21(24)25)19(23-27-3)15-20(18)28-29(4,5)6/h17-18,20H,7-15H2,1-6H3,(H,24,25)/b22-16-,23-19-/t17-,18-,20-/m1/s1 |
| InChIKey | XSVLHBWLAKQNFX-KRNHXPDCSA-N |
| XLogP | 5.07 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|