methoxymethane;octanoic acid

C10H22O3 — CID 87217062

IUPACmethoxymethane;octanoic acid
SMILESCCCCCCCC(=O)O.COC
InChIInChI=1S/C8H16O2.C2H6O/c1-2-3-4-5-6-7-8(9)10;1-3-2/h2-7H2,1H3,(H,9,10);1-2H3
InChIKeyJTAGTIWFEOFJNP-UHFFFAOYSA-N
MW190.28 g/mol
LogP2.69
Rot. Bonds6

About methoxymethane;octanoic acid

methoxymethane;octanoic acid (PubChem CID 87217062) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is methoxymethane;octanoic acid.

Molecular Properties

Compound Namemethoxymethane;octanoic acid
PubChem CID87217062
Molecular FormulaC10H22O3
Molecular Weight190.28 g/mol
Exact Mass190.16
IUPAC Namemethoxymethane;octanoic acid
SMILESCCCCCCCC(=O)O.COC
InChIInChI=1S/C8H16O2.C2H6O/c1-2-3-4-5-6-7-8(9)10;1-3-2/h2-7H2,1H3,(H,9,10);1-2H3
InChIKeyJTAGTIWFEOFJNP-UHFFFAOYSA-N
XLogP2.69
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.28
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methoxymethane;octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methoxymethane;octanoic acid?
The IUPAC name of methoxymethane;octanoic acid (CID 87217062) is methoxymethane;octanoic acid.
What is the SMILES notation for methoxymethane;octanoic acid?
The canonical SMILES for methoxymethane;octanoic acid is CCCCCCCC(=O)O.COC.
What is the InChIKey of methoxymethane;octanoic acid?
The InChIKey is JTAGTIWFEOFJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C2H6O/c1-2-3-4-5-6-7-8(9)10;1-3-2/h2-7H2,1H3,(H,9,10);1-2H3.
What are the key properties of methoxymethane;octanoic acid?
methoxymethane;octanoic acid has a molecular weight of 190.28 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;octanoic acid is sourced from PubChem (CID 87217062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).