C12H23N4NaO3 — CID 101277466
sodium (E)-N-[2-[2-[2-(ethylamino)ethylamino]ethylamino]ethyl]-4-hydroxy-4-oxobut-2-enimidate (PubChem CID 101277466) has the molecular formula C12H23N4NaO3 and a molecular weight of 294.33 g/mol. Its IUPAC name is sodium (E)-N-[2-[2-[2-(ethylamino)ethylamino]ethylamino]ethyl]-4-hydroxy-4-oxobut-2-enimidate.
| Compound Name | sodium (E)-N-[2-[2-[2-(ethylamino)ethylamino]ethylamino]ethyl]-4-hydroxy-4-oxobut-2-enimidate |
|---|---|
| PubChem CID | 101277466 |
| Molecular Formula | C12H23N4NaO3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | sodium (E)-N-[2-[2-[2-(ethylamino)ethylamino]ethylamino]ethyl]-4-hydroxy-4-oxobut-2-enimidate |
| SMILES | CCNCCNCCNCC/N=C([O-])/C=C/C(=O)O.[Na+] |
| InChI | InChI=1S/C12H24N4O3.Na/c1-2-13-5-6-14-7-8-15-9-10-16-11(17)3-4-12(18)19;/h3-4,13-15H,2,5-10H2,1H3,(H,16,17)(H,18,19);/q;+1/p-1/b4-3+; |
| InChIKey | PDLXVLLAVQPZJG-BJILWQEISA-M |
| XLogP | -4.82 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|