C10H16NNaO8 — CID 101231411
sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]but-2-enimidate (PubChem CID 101231411) has the molecular formula C10H16NNaO8 and a molecular weight of 301.23 g/mol. Its IUPAC name is sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]but-2-enimidate.
| Compound Name | sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]but-2-enimidate |
|---|---|
| PubChem CID | 101231411 |
| Molecular Formula | C10H16NNaO8 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | sodium (E)-4-hydroxy-4-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]but-2-enimidate |
| SMILES | O=C(O)/C=C/C([O-])=N/C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C10H17NO8.Na/c12-4-6(14)10(19)9(18)5(13)3-11-7(15)1-2-8(16)17;/h1-2,5-6,9-10,12-14,18-19H,3-4H2,(H,11,15)(H,16,17);/q;+1/p-1/b2-1+;/t5-,6+,9+,10+;/m0./s1 |
| InChIKey | NGDDRDNNELAIJQ-AENWNFRBSA-M |
| XLogP | -7.17 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|