C10H15N2NaO3 — CID 101277428
sodium (E)-N-[2-(but-3-enylamino)ethyl]-4-hydroxy-4-oxobut-2-enimidate (PubChem CID 101277428) has the molecular formula C10H15N2NaO3 and a molecular weight of 234.23 g/mol. Its IUPAC name is sodium (E)-N-[2-(but-3-enylamino)ethyl]-4-hydroxy-4-oxobut-2-enimidate.
| Compound Name | sodium (E)-N-[2-(but-3-enylamino)ethyl]-4-hydroxy-4-oxobut-2-enimidate |
|---|---|
| PubChem CID | 101277428 |
| Molecular Formula | C10H15N2NaO3 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | sodium (E)-N-[2-(but-3-enylamino)ethyl]-4-hydroxy-4-oxobut-2-enimidate |
| SMILES | C=CCCNCC/N=C([O-])/C=C/C(=O)O.[Na+] |
| InChI | InChI=1S/C10H16N2O3.Na/c1-2-3-6-11-7-8-12-9(13)4-5-10(14)15;/h2,4-5,11H,1,3,6-8H2,(H,12,13)(H,14,15);/q;+1/p-1/b5-4+; |
| InChIKey | LAKDBRZAADHFHV-FXRZFVDSSA-M |
| XLogP | -3.44 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|