C10H12O6 — CID 101281431
2-[3-oxo-3-[(E)-prop-1-enoxy]prop-1-en-2-yl]butanedioic acid (PubChem CID 101281431) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-[3-oxo-3-[(E)-prop-1-enoxy]prop-1-en-2-yl]butanedioic acid.
| Compound Name | 2-[3-oxo-3-[(E)-prop-1-enoxy]prop-1-en-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 101281431 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-[3-oxo-3-[(E)-prop-1-enoxy]prop-1-en-2-yl]butanedioic acid |
| SMILES | C=C(C(=O)O/C=C/C)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H12O6/c1-3-4-16-10(15)6(2)7(9(13)14)5-8(11)12/h3-4,7H,2,5H2,1H3,(H,11,12)(H,13,14)/b4-3+ |
| InChIKey | HBXOPWLUEBRGLJ-ONEGZZNKSA-N |
| XLogP | 0.79 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|