C19H27NO6 — CID 101320422
3-[di(hex-5-enoyl)amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoic acid (PubChem CID 101320422) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[di(hex-5-enoyl)amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoic acid.
| Compound Name | 3-[di(hex-5-enoyl)amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoic acid |
|---|---|
| PubChem CID | 101320422 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-[di(hex-5-enoyl)amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoic acid |
| SMILES | C=CCCCC(=O)N(C(=O)CCCC=C)C(CC(=O)O)C(=O)O/C=C/C |
| InChI | InChI=1S/C19H27NO6/c1-4-7-9-11-16(21)20(17(22)12-10-8-5-2)15(14-18(23)24)19(25)26-13-6-3/h4-6,13,15H,1-2,7-12,14H2,3H3,(H,23,24)/b13-6+ |
| InChIKey | BZFZGFVBDHUDOA-AWNIVKPZSA-N |
| XLogP | 2.97 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|