C21H30NNaO6 — CID 101320567
sodium 2-[bis[(E)-hept-5-enoyl]amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoate (PubChem CID 101320567) has the molecular formula C21H30NNaO6 and a molecular weight of 415.46 g/mol. Its IUPAC name is sodium 2-[bis[(E)-hept-5-enoyl]amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoate.
| Compound Name | sodium 2-[bis[(E)-hept-5-enoyl]amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoate |
|---|---|
| PubChem CID | 101320567 |
| Molecular Formula | C21H30NNaO6 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | sodium 2-[bis[(E)-hept-5-enoyl]amino]-4-oxo-4-[(E)-prop-1-enoxy]butanoate |
| SMILES | C/C=C/CCCC(=O)N(C(=O)CCC/C=C/C)C(CC(=O)O/C=C/C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H31NO6.Na/c1-4-7-9-11-13-18(23)22(19(24)14-12-10-8-5-2)17(21(26)27)16-20(25)28-15-6-3;/h4-8,15,17H,9-14,16H2,1-3H3,(H,26,27);/q;+1/p-1/b7-4+,8-5+,15-6+; |
| InChIKey | PPZYKEDRQJRMDV-VNJVZBASSA-M |
| XLogP | -0.58 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|