C20H29NO6 — CID 101320516
3-[bis[(E)-hept-4-enoyl]amino]-4-ethenoxy-4-oxobutanoic acid (PubChem CID 101320516) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is 3-[bis[(E)-hept-4-enoyl]amino]-4-ethenoxy-4-oxobutanoic acid.
| Compound Name | 3-[bis[(E)-hept-4-enoyl]amino]-4-ethenoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101320516 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[bis[(E)-hept-4-enoyl]amino]-4-ethenoxy-4-oxobutanoic acid |
| SMILES | C=COC(=O)C(CC(=O)O)N(C(=O)CC/C=C/CC)C(=O)CC/C=C/CC |
| InChI | InChI=1S/C20H29NO6/c1-4-7-9-11-13-17(22)21(18(23)14-12-10-8-5-2)16(15-19(24)25)20(26)27-6-3/h6-10,16H,3-5,11-15H2,1-2H3,(H,24,25)/b9-7+,10-8+ |
| InChIKey | MVVCAYZNICWFQT-FIFLTTCUSA-N |
| XLogP | 3.36 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|