C21H33NO6 — CID 101320536
3-[bis[(E)-hept-4-enoyl]amino]-4-oxo-4-propoxybutanoic acid (PubChem CID 101320536) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-[bis[(E)-hept-4-enoyl]amino]-4-oxo-4-propoxybutanoic acid.
| Compound Name | 3-[bis[(E)-hept-4-enoyl]amino]-4-oxo-4-propoxybutanoic acid |
|---|---|
| PubChem CID | 101320536 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-[bis[(E)-hept-4-enoyl]amino]-4-oxo-4-propoxybutanoic acid |
| SMILES | CC/C=C/CCC(=O)N(C(=O)CC/C=C/CC)C(CC(=O)O)C(=O)OCCC |
| InChI | InChI=1S/C21H33NO6/c1-4-7-9-11-13-18(23)22(19(24)14-12-10-8-5-2)17(16-20(25)26)21(27)28-15-6-3/h7-10,17H,4-6,11-16H2,1-3H3,(H,25,26)/b9-7+,10-8+ |
| InChIKey | CZQPDBNSKNQYEV-FIFLTTCUSA-N |
| XLogP | 3.63 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|