3,4-bis(pentoxycarbonyl)pent-4-enoic acid

C17H28O6 — CID 101281456

IUPAC3,4-bis(pentoxycarbonyl)pent-4-enoic acid
SMILESC=C(C(=O)OCCCCC)C(CC(=O)O)C(=O)OCCCCC
InChIInChI=1S/C17H28O6/c1-4-6-8-10-22-16(20)13(3)14(12-15(18)19)17(21)23-11-9-7-5-2/h14H,3-12H2,1-2H3,(H,18,19)
InChIKeyINEHGVDKLCZDNU-UHFFFAOYSA-N
MW328.41 g/mol
LogP3.10
Rot. Bonds13

About 3,4-bis(pentoxycarbonyl)pent-4-enoic acid

3,4-bis(pentoxycarbonyl)pent-4-enoic acid (PubChem CID 101281456) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3,4-bis(pentoxycarbonyl)pent-4-enoic acid.

Molecular Properties

Compound Name3,4-bis(pentoxycarbonyl)pent-4-enoic acid
PubChem CID101281456
Molecular FormulaC17H28O6
Molecular Weight328.41 g/mol
Exact Mass328.19
IUPAC Name3,4-bis(pentoxycarbonyl)pent-4-enoic acid
SMILESC=C(C(=O)OCCCCC)C(CC(=O)O)C(=O)OCCCCC
InChIInChI=1S/C17H28O6/c1-4-6-8-10-22-16(20)13(3)14(12-15(18)19)17(21)23-11-9-7-5-2/h14H,3-12H2,1-2H3,(H,18,19)
InChIKeyINEHGVDKLCZDNU-UHFFFAOYSA-N
XLogP3.10
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds13
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.41
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3,4-bis(pentoxycarbonyl)pent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis(pentoxycarbonyl)pent-4-enoic acid?
The IUPAC name of 3,4-bis(pentoxycarbonyl)pent-4-enoic acid (CID 101281456) is 3,4-bis(pentoxycarbonyl)pent-4-enoic acid.
What is the SMILES notation for 3,4-bis(pentoxycarbonyl)pent-4-enoic acid?
The canonical SMILES for 3,4-bis(pentoxycarbonyl)pent-4-enoic acid is C=C(C(=O)OCCCCC)C(CC(=O)O)C(=O)OCCCCC.
What is the InChIKey of 3,4-bis(pentoxycarbonyl)pent-4-enoic acid?
The InChIKey is INEHGVDKLCZDNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O6/c1-4-6-8-10-22-16(20)13(3)14(12-15(18)19)17(21)23-11-9-7-5-2/h14H,3-12H2,1-2H3,(H,18,19).
What are the key properties of 3,4-bis(pentoxycarbonyl)pent-4-enoic acid?
3,4-bis(pentoxycarbonyl)pent-4-enoic acid has a molecular weight of 328.41 g/mol, XLogP of 3.10, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(pentoxycarbonyl)pent-4-enoic acid is sourced from PubChem (CID 101281456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).