C16H26O6 — CID 101281462
tripropyl but-3-ene-1,2,3-tricarboxylate (PubChem CID 101281462) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is tripropyl but-3-ene-1,2,3-tricarboxylate.
| Compound Name | tripropyl but-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101281462 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tripropyl but-3-ene-1,2,3-tricarboxylate |
| SMILES | C=C(C(=O)OCCC)C(CC(=O)OCCC)C(=O)OCCC |
| InChI | InChI=1S/C16H26O6/c1-5-8-20-14(17)11-13(16(19)22-10-7-3)12(4)15(18)21-9-6-2/h13H,4-11H2,1-3H3 |
| InChIKey | SHEXTKVRPKMHQF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|