C29H44O12 — CID 101281233
2-O-[2-[2-(2-oxo-2-propoxyethyl)-3-propoxycarbonylbut-3-enoyl]oxypropyl] 1-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate (PubChem CID 101281233) has the molecular formula C29H44O12 and a molecular weight of 584.66 g/mol. Its IUPAC name is 2-O-[2-[2-(2-oxo-2-propoxyethyl)-3-propoxycarbonylbut-3-enoyl]oxypropyl] 1-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate.
| Compound Name | 2-O-[2-[2-(2-oxo-2-propoxyethyl)-3-propoxycarbonylbut-3-enoyl]oxypropyl] 1-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101281233 |
| Molecular Formula | C29H44O12 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 2-O-[2-[2-(2-oxo-2-propoxyethyl)-3-propoxycarbonylbut-3-enoyl]oxypropyl] 1-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
| SMILES | C=C(C(=O)OCCC)C(CC(=O)OCCC)C(=O)OCC(C)OC(=O)C(CC(=O)OCCC)C(=C)C(=O)OCCC |
| InChI | InChI=1S/C29H44O12/c1-8-12-36-24(30)16-22(20(6)26(32)38-14-10-3)28(34)40-18-19(5)41-29(35)23(17-25(31)37-13-9-2)21(7)27(33)39-15-11-4/h19,22-23H,6-18H2,1-5H3 |
| InChIKey | INDCQGFCFWSFJN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|