C30H46O12 — CID 101281253
1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]butyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate (PubChem CID 101281253) has the molecular formula C30H46O12 and a molecular weight of 598.69 g/mol. Its IUPAC name is 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]butyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate.
| Compound Name | 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]butyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101281253 |
| Molecular Formula | C30H46O12 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]butyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
| SMILES | C=C(C(=O)OCCC)C(CC(=O)OCC(CC)OC(=O)CC(C(=C)C(=O)OCCC)C(=O)OCCC)C(=O)OCCC |
| InChI | InChI=1S/C30H46O12/c1-8-13-37-27(33)20(6)23(29(35)39-15-10-3)17-25(31)41-19-22(12-5)42-26(32)18-24(30(36)40-16-11-4)21(7)28(34)38-14-9-2/h22-24H,6-19H2,1-5H3 |
| InChIKey | FLVYBKRLDMVZHK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|