C28H42O12 — CID 101281217
1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]ethyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate (PubChem CID 101281217) has the molecular formula C28H42O12 and a molecular weight of 570.63 g/mol. Its IUPAC name is 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]ethyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate.
| Compound Name | 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]ethyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101281217 |
| Molecular Formula | C28H42O12 |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 1-O-[2-[3,4-bis(propoxycarbonyl)pent-4-enoyloxy]ethyl] 2-O,3-O-dipropyl but-3-ene-1,2,3-tricarboxylate |
| SMILES | C=C(C(=O)OCCC)C(CC(=O)OCCOC(=O)CC(C(=C)C(=O)OCCC)C(=O)OCCC)C(=O)OCCC |
| InChI | InChI=1S/C28H42O12/c1-7-11-37-25(31)19(5)21(27(33)39-13-9-3)17-23(29)35-15-16-36-24(30)18-22(28(34)40-14-10-4)20(6)26(32)38-12-8-2/h21-22H,5-18H2,1-4H3 |
| InChIKey | NMAQWLXKJYONOD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|