About 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate
1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate (PubChem CID 173239867) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate.
Molecular Properties
| Compound Name | 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate |
| PubChem CID | 173239867 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate |
| SMILES | CCCOC(=O)CC(C)C(=O)OC(C)C |
| InChI | InChI=1S/C11H20O4/c1-5-6-14-10(12)7-9(4)11(13)15-8(2)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | JLZBUBGEORBKLT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate?
The IUPAC name of 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate (CID 173239867) is 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate.
What is the SMILES notation for 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate?
The canonical SMILES for 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate is CCCOC(=O)CC(C)C(=O)OC(C)C.
What is the InChIKey of 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate?
The InChIKey is JLZBUBGEORBKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-5-6-14-10(12)7-9(4)11(13)15-8(2)3/h8-9H,5-7H2,1-4H3.
What are the key properties of 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate?
1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate has a molecular weight of 216.28 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-propan-2-yl 4-O-propyl 2-methylbutanedioate is sourced from PubChem (CID 173239867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).