C22H30O13 — CID 101281396
3-O-[2-[2-(5-methoxy-3-methoxycarbonyl-2-methylidene-5-oxopentanoyl)oxyethoxy]ethyl] 1-O,2-O-dimethyl but-3-ene-1,2,3-tricarboxylate (PubChem CID 101281396) has the molecular formula C22H30O13 and a molecular weight of 502.47 g/mol. Its IUPAC name is 3-O-[2-[2-(5-methoxy-3-methoxycarbonyl-2-methylidene-5-oxopentanoyl)oxyethoxy]ethyl] 1-O,2-O-dimethyl but-3-ene-1,2,3-tricarboxylate.
| Compound Name | 3-O-[2-[2-(5-methoxy-3-methoxycarbonyl-2-methylidene-5-oxopentanoyl)oxyethoxy]ethyl] 1-O,2-O-dimethyl but-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101281396 |
| Molecular Formula | C22H30O13 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-O-[2-[2-(5-methoxy-3-methoxycarbonyl-2-methylidene-5-oxopentanoyl)oxyethoxy]ethyl] 1-O,2-O-dimethyl but-3-ene-1,2,3-tricarboxylate |
| SMILES | C=C(C(=O)OCCOCCOC(=O)C(=C)C(CC(=O)OC)C(=O)OC)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H30O13/c1-13(15(21(27)31-5)11-17(23)29-3)19(25)34-9-7-33-8-10-35-20(26)14(2)16(22(28)32-6)12-18(24)30-4/h15-16H,1-2,7-12H2,3-6H3 |
| InChIKey | YYGFCIWHMPNBQN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|