C27H36N2O6 — CID 101281486
2-[(2R,9R,12R,14R,22S)-14-ethyl-18,19-dimethoxy-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(20),17(21),18-trien-9-yl]ethyl acetate (PubChem CID 101281486) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[(2R,9R,12R,14R,22S)-14-ethyl-18,19-dimethoxy-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(20),17(21),18-trien-9-yl]ethyl acetate.
| Compound Name | 2-[(2R,9R,12R,14R,22S)-14-ethyl-18,19-dimethoxy-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(20),17(21),18-trien-9-yl]ethyl acetate |
|---|---|
| PubChem CID | 101281486 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[(2R,9R,12R,14R,22S)-14-ethyl-18,19-dimethoxy-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(20),17(21),18-trien-9-yl]ethyl acetate |
| SMILES | CC[C@@H]1COc2c(OC)c(OC)cc3c2N1[C@@H]1CC(=O)[C@@]2(CCOC(C)=O)CCCN4CC[C@@]31[C@H]42 |
| InChI | InChI=1S/C27H36N2O6/c1-5-17-15-35-24-22-18(13-19(32-3)23(24)33-4)27-8-11-28-10-6-7-26(25(27)28,9-12-34-16(2)30)21(31)14-20(27)29(17)22/h13,17,20,25H,5-12,14-15H2,1-4H3/t17-,20-,25-,26+,27-/m1/s1 |
| InChIKey | HOKYRWDUYDTIEE-UUKOEBCQSA-N |
| XLogP | 3.08 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|