C25H32N2O5 — CID 602659
2-(18-methoxy-14-methyl-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(21),17,19-trien-9-yl)ethyl acetate (PubChem CID 602659) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-(18-methoxy-14-methyl-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(21),17,19-trien-9-yl)ethyl acetate.
| Compound Name | 2-(18-methoxy-14-methyl-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(21),17,19-trien-9-yl)ethyl acetate |
|---|---|
| PubChem CID | 602659 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-(18-methoxy-14-methyl-10-oxo-16-oxa-5,13-diazahexacyclo[11.7.1.12,5.02,12.017,21.09,22]docosa-1(21),17,19-trien-9-yl)ethyl acetate |
| SMILES | COc1ccc2c3c1OCC(C)N3C1CC(=O)C3(CCOC(C)=O)CCCN4CCC21C43 |
| InChI | InChI=1S/C25H32N2O5/c1-15-14-32-22-18(30-3)6-5-17-21(22)27(15)19-13-20(29)24(9-12-31-16(2)28)7-4-10-26-11-8-25(17,19)23(24)26/h5-6,15,19,23H,4,7-14H2,1-3H3 |
| InChIKey | AUHZQJMSMXXJAM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |