C32H54O5 — CID 101281503
[2-hydroxy-2-[(3S,5R,8S,10S,13S,14S,17S)-3-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-4-yl] acetate (PubChem CID 101281503) has the molecular formula C32H54O5 and a molecular weight of 518.78 g/mol. Its IUPAC name is [2-hydroxy-2-[(3S,5R,8S,10S,13S,14S,17S)-3-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-4-yl] acetate.
| Compound Name | [2-hydroxy-2-[(3S,5R,8S,10S,13S,14S,17S)-3-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-4-yl] acetate |
|---|---|
| PubChem CID | 101281503 |
| Molecular Formula | C32H54O5 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | [2-hydroxy-2-[(3S,5R,8S,10S,13S,14S,17S)-3-hydroxy-13-(hydroxymethyl)-4,4,10,14-tetramethyl-2,3,5,6,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylheptan-4-yl] acetate |
| SMILES | CC(=O)OC(CC(C)C)CC(C)(O)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]12CO |
| InChI | InChI=1S/C32H54O5/c1-20(2)17-22(37-21(3)34)18-31(8,36)26-12-15-30(7)24-9-10-25-28(4,5)27(35)13-14-29(25,6)23(24)11-16-32(26,30)19-33/h11,20,22,24-27,33,35-36H,9-10,12-19H2,1-8H3/t22?,24-,25+,26-,27+,29-,30+,31?,32+/m1/s1 |
| InChIKey | BSJYXPNUMSMHAQ-FZUPXEGWSA-N |
| XLogP | 6.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|