C17H32NO5+ — CID 101281810
bis(1-carboxypropyl)-(hydroxymethyl)-[(E)-oct-1-enyl]azanium (PubChem CID 101281810) has the molecular formula C17H32NO5+ and a molecular weight of 330.45 g/mol. Its IUPAC name is bis(1-carboxypropyl)-(hydroxymethyl)-[(E)-oct-1-enyl]azanium.
| Compound Name | bis(1-carboxypropyl)-(hydroxymethyl)-[(E)-oct-1-enyl]azanium |
|---|---|
| PubChem CID | 101281810 |
| Molecular Formula | C17H32NO5+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | bis(1-carboxypropyl)-(hydroxymethyl)-[(E)-oct-1-enyl]azanium |
| SMILES | CCCCCC/C=C/[N+](CO)(C(CC)C(=O)O)C(CC)C(=O)O |
| InChI | InChI=1S/C17H31NO5/c1-4-7-8-9-10-11-12-18(13-19,14(5-2)16(20)21)15(6-3)17(22)23/h11-12,14-15,19H,4-10,13H2,1-3H3,(H-,20,21,22,23)/p+1/b12-11+ |
| InChIKey | FILYNJKCOKLIJV-VAWYXSNFSA-O |
| XLogP | 2.96 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|