C17H32N2O4 — CID 101284045
2-[[(Z)-2-hydroxyhex-2-enyl]-[2-[[(Z)-2-hydroxyhex-2-enyl]amino]ethyl]amino]propanoic acid (PubChem CID 101284045) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-[[(Z)-2-hydroxyhex-2-enyl]-[2-[[(Z)-2-hydroxyhex-2-enyl]amino]ethyl]amino]propanoic acid.
| Compound Name | 2-[[(Z)-2-hydroxyhex-2-enyl]-[2-[[(Z)-2-hydroxyhex-2-enyl]amino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101284045 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2-[[(Z)-2-hydroxyhex-2-enyl]-[2-[[(Z)-2-hydroxyhex-2-enyl]amino]ethyl]amino]propanoic acid |
| SMILES | CCC/C=C(\O)CNCCN(C/C(O)=C/CCC)C(C)C(=O)O |
| InChI | InChI=1S/C17H32N2O4/c1-4-6-8-15(20)12-18-10-11-19(14(3)17(22)23)13-16(21)9-7-5-2/h8-9,14,18,20-21H,4-7,10-13H2,1-3H3,(H,22,23)/b15-8-,16-9- |
| InChIKey | QETIKURNPYDLHM-SRKDFGFSSA-N |
| XLogP | 2.84 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|