C26H26N2O5S2 — CID 10128406
[5-[[4-(dimethylamino)phenyl]methylsulfamoyl]naphthalen-1-yl] 4-methylbenzenesulfonate (PubChem CID 10128406) has the molecular formula C26H26N2O5S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is [5-[[4-(dimethylamino)phenyl]methylsulfamoyl]naphthalen-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-[[4-(dimethylamino)phenyl]methylsulfamoyl]naphthalen-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10128406 |
| Molecular Formula | C26H26N2O5S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | [5-[[4-(dimethylamino)phenyl]methylsulfamoyl]naphthalen-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc3c(S(=O)(=O)NCc4ccc(N(C)C)cc4)cccc23)cc1 |
| InChI | InChI=1S/C26H26N2O5S2/c1-19-10-16-22(17-11-19)35(31,32)33-25-8-4-7-24-23(25)6-5-9-26(24)34(29,30)27-18-20-12-14-21(15-13-20)28(2)3/h4-17,27H,18H2,1-3H3 |
| InChIKey | VVAMJWQCRKYYTE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|