C21H23NO5S3 — CID 89009287
5-[2-(4-methylphenyl)sulfonylethoxy]-N-(2-sulfanylethyl)naphthalene-1-sulfonamide (PubChem CID 89009287) has the molecular formula C21H23NO5S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is 5-[2-(4-methylphenyl)sulfonylethoxy]-N-(2-sulfanylethyl)naphthalene-1-sulfonamide.
| Compound Name | 5-[2-(4-methylphenyl)sulfonylethoxy]-N-(2-sulfanylethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 89009287 |
| Molecular Formula | C21H23NO5S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 5-[2-(4-methylphenyl)sulfonylethoxy]-N-(2-sulfanylethyl)naphthalene-1-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)CCOc2cccc3c(S(=O)(=O)NCCS)cccc23)cc1 |
| InChI | InChI=1S/C21H23NO5S3/c1-16-8-10-17(11-9-16)29(23,24)15-13-27-20-6-2-5-19-18(20)4-3-7-21(19)30(25,26)22-12-14-28/h2-11,22,28H,12-15H2,1H3 |
| InChIKey | GUMAAAFWNOGAPE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|