C19H22O8 — CID 101285181
(1S,2R,4R,5R,10S,11R,13S,14R,15R,18R)-14-hydroxy-5-(1-hydroxypropan-2-yl)-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione (PubChem CID 101285181) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is (1S,2R,4R,5R,10S,11R,13S,14R,15R,18R)-14-hydroxy-5-(1-hydroxypropan-2-yl)-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione.
| Compound Name | (1S,2R,4R,5R,10S,11R,13S,14R,15R,18R)-14-hydroxy-5-(1-hydroxypropan-2-yl)-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
|---|---|
| PubChem CID | 101285181 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (1S,2R,4R,5R,10S,11R,13S,14R,15R,18R)-14-hydroxy-5-(1-hydroxypropan-2-yl)-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
| SMILES | CC(CO)[C@H]1OC(=O)C=C2[C@]3(C)[C@H]4[C@H](OC(=O)[C@@]4(C)[C@@H](O)[C@@H]4O[C@@H]43)[C@H]3O[C@]213 |
| InChI | InChI=1S/C19H22O8/c1-6(5-20)13-19-7(4-8(21)24-13)17(2)11-9(15(19)27-19)26-16(23)18(11,3)12(22)10-14(17)25-10/h4,6,9-15,20,22H,5H2,1-3H3/t6?,9-,10-,11+,12-,13+,14-,15+,17+,18+,19+/m0/s1 |
| InChIKey | YQFRZQHSRXENRA-QQADTOCDSA-N |
| XLogP | -0.69 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|