C20H24O9S — CID 101470114
(1S,2R,4S,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-5-[(2R)-2-hydroxy-1-methylsulfinylpropan-2-yl]-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione (PubChem CID 101470114) has the molecular formula C20H24O9S and a molecular weight of 440.47 g/mol. Its IUPAC name is (1S,2R,4S,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-5-[(2R)-2-hydroxy-1-methylsulfinylpropan-2-yl]-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione.
| Compound Name | (1S,2R,4S,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-5-[(2R)-2-hydroxy-1-methylsulfinylpropan-2-yl]-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
|---|---|
| PubChem CID | 101470114 |
| Molecular Formula | C20H24O9S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (1S,2R,4S,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-5-[(2R)-2-hydroxy-1-methylsulfinylpropan-2-yl]-10,15-dimethyl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
| SMILES | CS(=O)C[C@](C)(O)[C@H]1OC(=O)C=C2[C@]3(C)[C@H]4[C@H](OC(=O)[C@@]4(C)[C@@H](O)[C@H]4O[C@H]43)[C@H]3O[C@@]231 |
| InChI | InChI=1S/C20H24O9S/c1-17(24,6-30(4)25)15-20-7(5-8(21)26-15)18(2)11-9(14(20)29-20)28-16(23)19(11,3)12(22)10-13(18)27-10/h5,9-15,22,24H,6H2,1-4H3/t9-,10+,11+,12-,13+,14+,15+,17-,18+,19+,20-,30?/m0/s1 |
| InChIKey | FTJAQTOZTDHBDI-VMBDWTJASA-N |
| XLogP | -1.18 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|