C16H16O6 — CID 162920954
(1S,2S,4R,5R,6R,9R,17S)-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-10,15-diene-7,14-dione (PubChem CID 162920954) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1S,2S,4R,5R,6R,9R,17S)-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-10,15-diene-7,14-dione.
| Compound Name | (1S,2S,4R,5R,6R,9R,17S)-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-10,15-diene-7,14-dione |
|---|---|
| PubChem CID | 162920954 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1S,2S,4R,5R,6R,9R,17S)-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-10,15-diene-7,14-dione |
| SMILES | C[C@@]12C3=CC(=O)OCC3=C[C@H]3OC(=O)[C@](C)([C@@H]31)[C@@H](O)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C16H16O6/c1-15-7-4-9(17)20-5-6(7)3-8-11(15)16(2,14(19)21-8)12(18)10-13(15)22-10/h3-4,8,10-13,18H,5H2,1-2H3/t8-,10-,11+,12+,13-,15-,16-/m1/s1 |
| InChIKey | UBQJSYFOVWBSFP-RCXTVQLXSA-N |
| XLogP | 0.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|