C24H28O10 — CID 102194128
[(1S,2R,4S,5R,10S,11R,13R,14R,15R,18R)-10,15-dimethyl-7,16-dioxo-5-(1-propanoyloxyethyl)-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-en-14-yl] propanoate (PubChem CID 102194128) has the molecular formula C24H28O10 and a molecular weight of 476.48 g/mol. Its IUPAC name is [(1S,2R,4S,5R,10S,11R,13R,14R,15R,18R)-10,15-dimethyl-7,16-dioxo-5-(1-propanoyloxyethyl)-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-en-14-yl] propanoate.
| Compound Name | [(1S,2R,4S,5R,10S,11R,13R,14R,15R,18R)-10,15-dimethyl-7,16-dioxo-5-(1-propanoyloxyethyl)-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-en-14-yl] propanoate |
|---|---|
| PubChem CID | 102194128 |
| Molecular Formula | C24H28O10 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [(1S,2R,4S,5R,10S,11R,13R,14R,15R,18R)-10,15-dimethyl-7,16-dioxo-5-(1-propanoyloxyethyl)-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-en-14-yl] propanoate |
| SMILES | CCC(=O)OC(C)[C@H]1OC(=O)C=C2[C@]3(C)[C@H]4[C@H](OC(=O)[C@@]4(C)[C@@H](OC(=O)CC)[C@@H]4O[C@@H]43)[C@H]3O[C@]213 |
| InChI | InChI=1S/C24H28O10/c1-6-11(25)29-9(3)17-24-10(8-13(27)31-17)22(4)16-14(20(24)34-24)33-21(28)23(16,5)19(15-18(22)32-15)30-12(26)7-2/h8-9,14-20H,6-7H2,1-5H3/t9?,14-,15+,16+,17+,18-,19-,20+,22+,23+,24+/m0/s1 |
| InChIKey | UCBAESNNPDJWNH-FLQQHUHSSA-N |
| XLogP | 0.99 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|