C12H10Cl4O2 — CID 101293464
2-[1-(2,3,5,6-tetrachlorophenoxy)but-3-enyl]oxirane (PubChem CID 101293464) has the molecular formula C12H10Cl4O2 and a molecular weight of 328.02 g/mol. Its IUPAC name is 2-[1-(2,3,5,6-tetrachlorophenoxy)but-3-enyl]oxirane.
| Compound Name | 2-[1-(2,3,5,6-tetrachlorophenoxy)but-3-enyl]oxirane |
|---|---|
| PubChem CID | 101293464 |
| Molecular Formula | C12H10Cl4O2 |
| Molecular Weight | 328.02 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 2-[1-(2,3,5,6-tetrachlorophenoxy)but-3-enyl]oxirane |
| SMILES | C=CCC(Oc1c(Cl)c(Cl)cc(Cl)c1Cl)C1CO1 |
| InChI | InChI=1S/C12H10Cl4O2/c1-2-3-8(9-5-17-9)18-12-10(15)6(13)4-7(14)11(12)16/h2,4,8-9H,1,3,5H2 |
| InChIKey | LUVLRRQXINZQKW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|