C22H44O4 — CID 101294775
1,1-bis(3-ethylpentan-3-ylperoxy)-4,4-dimethylcyclohexane (PubChem CID 101294775) has the molecular formula C22H44O4 and a molecular weight of 372.59 g/mol. Its IUPAC name is 1,1-bis(3-ethylpentan-3-ylperoxy)-4,4-dimethylcyclohexane.
| Compound Name | 1,1-bis(3-ethylpentan-3-ylperoxy)-4,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 101294775 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 1,1-bis(3-ethylpentan-3-ylperoxy)-4,4-dimethylcyclohexane |
| SMILES | CCC(CC)(CC)OOC1(OOC(CC)(CC)CC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C22H44O4/c1-9-20(10-2,11-3)23-25-22(17-15-19(7,8)16-18-22)26-24-21(12-4,13-5)14-6/h9-18H2,1-8H3 |
| InChIKey | CLZVNEPVJSZQFW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|