C24H48O4 — CID 101294828
1,1-bis(3-ethylhexan-3-ylperoxy)-3,5-dimethylcyclohexane (PubChem CID 101294828) has the molecular formula C24H48O4 and a molecular weight of 400.64 g/mol. Its IUPAC name is 1,1-bis(3-ethylhexan-3-ylperoxy)-3,5-dimethylcyclohexane.
| Compound Name | 1,1-bis(3-ethylhexan-3-ylperoxy)-3,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 101294828 |
| Molecular Formula | C24H48O4 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | 1,1-bis(3-ethylhexan-3-ylperoxy)-3,5-dimethylcyclohexane |
| SMILES | CCCC(CC)(CC)OOC1(OOC(CC)(CC)CCC)CC(C)CC(C)C1 |
| InChI | InChI=1S/C24H48O4/c1-9-15-22(11-3,12-4)25-27-24(18-20(7)17-21(8)19-24)28-26-23(13-5,14-6)16-10-2/h20-21H,9-19H2,1-8H3 |
| InChIKey | JKZVHKSSEYRHMI-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|