C24H20N6O10 — CID 101298741
(2,5-dioxopyrrolidin-1-yl) (2S)-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 101298741) has the molecular formula C24H20N6O10 and a molecular weight of 552.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 101298741 |
| Molecular Formula | C24H20N6O10 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@@H](Cc1cncn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H20N6O10/c31-21-8-9-22(32)28(21)40-23(33)18(26-24(34)39-13-15-4-2-1-3-5-15)10-17-12-25-14-27(17)19-7-6-16(29(35)36)11-20(19)30(37)38/h1-7,11-12,14,18H,8-10,13H2,(H,26,34)/t18-/m0/s1 |
| InChIKey | ZLVHYWFATVOEEJ-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 206.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|