C26H29N5O9S — CID 22845096
(2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid (PubChem CID 22845096) has the molecular formula C26H29N5O9S and a molecular weight of 587.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22845096 |
| Molecular Formula | C26H29N5O9S |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid |
| SMILES | CC(C)(C)S(=O)(=O)C[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cncn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C26H29N5O9S/c1-26(2,3)41(39,40)15-18(11-17-7-5-4-6-8-17)24(32)28-21(25(33)34)12-20-14-27-16-29(20)22-10-9-19(30(35)36)13-23(22)31(37)38/h4-10,13-14,16,18,21H,11-12,15H2,1-3H3,(H,28,32)(H,33,34)/t18-,21+/m1/s1 |
| InChIKey | ZJQJKZZFKKZNCQ-NQIIRXRSSA-N |
| XLogP | 2.87 |
| TPSA | 204.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|