C27H33N5O9S — CID 57008681
4-[(2R)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]propyl]-3-(2,4-dinitrophenyl)-2H-imidazole-1-carboxylic acid (PubChem CID 57008681) has the molecular formula C27H33N5O9S and a molecular weight of 603.65 g/mol. Its IUPAC name is 4-[(2R)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]propyl]-3-(2,4-dinitrophenyl)-2H-imidazole-1-carboxylic acid.
| Compound Name | 4-[(2R)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]propyl]-3-(2,4-dinitrophenyl)-2H-imidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 57008681 |
| Molecular Formula | C27H33N5O9S |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 4-[(2R)-2-[[(2S)-2-benzyl-3-tert-butylsulfonylpropanoyl]amino]propyl]-3-(2,4-dinitrophenyl)-2H-imidazole-1-carboxylic acid |
| SMILES | C[C@H](CC1=CN(C(=O)O)CN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC(=O)[C@H](Cc1ccccc1)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C27H33N5O9S/c1-18(28-25(33)20(13-19-8-6-5-7-9-19)16-42(40,41)27(2,3)4)12-22-15-29(26(34)35)17-30(22)23-11-10-21(31(36)37)14-24(23)32(38)39/h5-11,14-15,18,20H,12-13,16-17H2,1-4H3,(H,28,33)(H,34,35)/t18-,20-/m1/s1 |
| InChIKey | HEPILTBLPCVUCU-UYAOXDASSA-N |
| XLogP | 4.07 |
| TPSA | 193.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|